Tricin
| PubChem CID | 5281702 |
| Molecular Formula | C17H14O7 |
| Structure |
|
| Synonyms |
Tricin
520-32-1 5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-4H-chromen-4-one 3',5'-DIMETHOXY-4',5,7-TRIHYDROXYFLAVONE 5,7,4'-trihydroxy-3',5'-dimethoxyflavone 5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)chromen-4-one 3',5'-O-dimethyltricetin D51JZL38TQ CHEBI:59979 UNII-D51JZL38TQ NSC-294579 5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxy-phenyl)chromen-4-one DTXSID20199965 Tricetin 3',5'-di-methyl ether 5,7-Dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-4H-1-benzopyran-4-one 3',5'-di-O-methyltricetin NSC 294579 4',5,7-TRIHYDROXY-3',5'-DIMETHOXY-FLAVONE FLAVONE, 4',5,7-TRIHYDROXY-3',5'-DIMETHOXY- 4H-1-BENZOPYRAN-4-ONE, 5,7-DIHYDROXY-2-(4-HYDROXY-3,5-DIMETHOXYPHENYL)- Tricin? 5,7,4'-trihydroxy-3',5'-dimethoxy-flavone SCHEMBL44475 CHEMBL454320 3\\',5\\'-di-O-methyltricetin DTXCID80122456 HRGUSFBJBOKSML-UHFFFAOYSA-N AMY33321 EX-A6798 HY-N1127 BDBM50487758 LMPK12110873 MFCD00210580 NSC294579 STK694538 AKOS005606119 3,5-Dimethoxy-4,5,7-trihydroxyflavone AC-34503 AS-78676 DA-78609 CS-0016415 NS00122041 Q3055452 F0001-1352 |
Computed Descriptors
| IUPAC Name | 5,7-dihydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)chromen-4-one |
| SMILES | COC1=CC(=CC(=C1O)OC)C2=CC(=O)C3=C(C=C(C=C3O2)O)O |
| Canonical SMILES | COC1=CC(=CC(=C1O)OC)C2=CC(=O)C3=C(C=C(C=C3O2)O)O |
| InChI | InChI=1S/C17H14O7/c1-22-14-3-8(4-15(23-2)17(14)21)12-7-11(20)16-10(19)5-9(18)6-13(16)24-12/h3-7,18-19,21H,1-2H3 |
| InChIKey | HRGUSFBJBOKSML-UHFFFAOYSA-N |
Computed Properties
Show more
| Molecular Weight | 330.29 g/mol |
| XLogP3 | 1.7 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 3 |
| Exact Mass | 330.074 |
| Monoisotopic Mass | 330.074 |
| Topological Polar Surface Area | 105 |
| Heavy Atom Count | 24 |
| Formal Charge | 0 |
| Complexity | 491 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently-Bonded Unit Count | 1 |
1 pairs of Verified P450 and Tricin
| Insect | Gene Symbol | Validation | Reference |
|---|---|---|---|
| Spodoptera frugiperda | CYP321A9 | R |