PubChem CID | 444539 |
Molecular Formula | C9H8O2 |
Structure |
![]() |
Synonyms |
CINNAMIC ACID
TRANS-CINNAMIC ACID 140-10-3 621-82-9 3-Phenylacrylic acid (E)-Cinnamic acid trans-3-Phenylacrylic acid Phenylacrylic acid Zimtsaeure (E)-3-phenylprop-2-enoic acid E-Cinnamic Acid 3-Phenylpropenoic acid trans-Cinnamate 2-Propenoic acid, 3-phenyl-, (2E)- (2E)-3-phenylprop-2-enoic acid 3-phenylprop-2-enoic acid Cinnamic acid, (E)- trans-beta-Carboxystyrene (2E)-3-Phenyl-2-propenoic acid beta-Phenylacrylic acid Cinnamylic acid (E)-cinnamate Benzeneacrylic acid trans-3-Phenyl-2-propenoic acid 3-Phenyl-2-propenoic acid Benzenepropenoic acid FEMA No. 2288 CCRIS 3190 2-Propenoic acid, 3-phenyl-, (E)- (E)-3-Phenyl-2-propenoic acid t-Cinnamic acid EINECS 205-398-1 MFCD00004369 NSC 44010 Benzylideneacetic acid UNII-U14A832J8D BRN 1905952 CINNAMIC ACIDUM AI3-23709 Cinnamic acid, trans- Kyselina skoricove PhCH=CHCO2H Acidum cinnamylicum U14A832J8D (2E)-2-Phenyl-2-propenoic acid PHENYLETHYLENECARBOXYLIC ACID NSC-9189 NSC-44010 Cinnamic acid(only trans) NSC-623441 (2E)-3-phenylacrylic acid CHEMBL27246 Cinnamic acid (natural) DTXSID5022489 CHEBI:27386 CHEBI:35697 NSC 9189 cinnamate 4-09-00-02002 (Beilstein Handbook Reference) Heparin, lithium salt NCGC00165979-01 EINECS 210-708-3 BRN 0507757 AI3-00891 CINNAMIC ACID (MART.) CINNAMIC ACID [MART.] DTXCID002489 CINNAMIC ACID (USP-RS) CINNAMIC ACID [USP-RS] (E)-3-phenylprop-2-enoate CAS-140-10-3 .beta.-Phenylacrylic acid propenoic acid, 3-phenyl- (E)-3-Phenylacrylic acid DTXSID40110056 trans-Zimtsaeure NSC 623441 trans cinnamic acid cinnamic acid, (trans)-(E)-isomer Cinnamic acid, E- Cinnamic Acid Natural Cinnamic Acid1511 trans-b-Carboxystyrene Cinnamicacid(onlytrans) trans-3-Phenylacrylate (E)-3-Phenylacrylate E-3-phenylpropenoic acid Trans-Cinnamic Acid,(S) bmse000124 CINNAMIC ACID [MI] SCHEMBL1332 trans-.beta.-Carboxystyrene trans-Cinnamic acid, 97% trans-Cinnamic acid, 99% WLN: QV1U1R (E)-3-phenyl-acrylic acid 3-phenyl-2E-propenoic acid CINNAMIC ACID [FCC] Zimtsaeure trans-Cinnamate CINNAMIC ACID [FHFI] trans-3-Phenyl-2-propenoate BIDD:ER0586 tert-.beta.-Phenylacrylic acid trans-Cinnamic acid, >=99% (2E)-2-Phenyl-2-propenoate (2E)-3-Phenyl-2-propenoate GTPL3203 CINNAMIC ACID [WHO-DD] DTXCID9065316 BDBM16430 HY-N0610A NSC9189 NSC44010 STR00363 trans-Cinnamic acid, >=99%, FG Tox21_112279 Tox21_302137 BBL036895 NSC623441 s3677 STK286093 AKOS000118871 CCG-214473 CS-W020005 trans-Cinnamic acid, analytical standard NCGC00165979-04 NCGC00165979-06 NCGC00255114-01 1ST40140 AC-34658 AS-75479 BP-20203 3-Phenylacrylic acid; -Phenylacrylic acid DB-003797 DB-215130 C3412 NS00001286 EN300-19599 trans-Cinnamic acid, purum, >=99.0% (T) C00423 D70605 EN300-306004 SBI-0633522.0003 AB00374254-03 trans-cinnamic acid (trans-3-phenylacrylic acid) trans-Cinnamic Acid [Matrix for MALDI-TOF/MS] A833631 Q164785 SR-05000002380 trans-Cinnamic acid, natural, >=99%, FCC, FG Q-100150 SR-05000002380-1 W-105037 F2191-0134 trans-Cinnamic Acid Zone Refined (number of passes:40) trans-Cinnamic acid; Phenylacrylic acid;Cinnamylic acid Z104474406 1BE36587-A165-4142-9340-18FFE3E03426 CINNAMIC ACID (CONSTITUENT OF CINNAMOMUM VERUM BARK) [DSC] Cinnamic acid, United States Pharmacopeia (USP) Reference Standard TRANS-CINNAMIC ACID (CONSTITUENT OF CINNAMOMUM CASSIA BARK) [DSC] InChI=1/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6 |
IUPAC Name | (E)-3-phenylprop-2-enoic acid |
SMILES | C1=CC=C(C=C1)/C=C/C(=O)O |
Canonical SMILES | C1=CC=C(C=C1)C=CC(=O)O |
InChI | InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6+ |
InChIKey | WBYWAXJHAXSJNI-VOTSOKGWSA-N |
Molecular Weight | 148.16 g/mol |
XLogP3 | 2.1 |
Hydrogen Bond Donor Count | 1 |
Hydrogen Bond Acceptor Count | 2 |
Rotatable Bond Count | 2 |
Exact Mass | 148.052 |
Monoisotopic Mass | 148.052 |
Topological Polar Surface Area | 37.3 |
Heavy Atom Count | 11 |
Formal Charge | 0 |
Complexity | 155 |
Isotope Atom Count | 0 |
Defined Atom Stereocenter Count | 0 |
Undefined Atom Stereocenter Count | 0 |
Defined Bond Stereocenter Count | 1 |
Undefined Bond Stereocenter Count | 0 |
Covalently-Bonded Unit Count | 1 |
Insect | Gene Symbol | Validation | Reference |
---|---|---|---|
Spodoptera litura | CYP9A40 | R |