| PubChem CID | 440917 |
| Molecular Formula | C10H16 |
| Structure |
|
| Synonyms |
D-Limonene
5989-27-5 (+)-Limonene (R)-(+)-Limonene (D)-Limonene (4R)-Limonene (+)-(4R)-Limonene (+)-carvene (R)-Limonene (+)-Dipentene D-(+)-Limonene D-Limonen Limonene, D- Citrene (R)-4-Isopropenyl-1-methyl-1-cyclohexene Limonene, (+)- (R)-p-Mentha-1,8-diene (+)-p-Mentha-1,8-diene (+)-R-Limonene (4R)-4-isopropenyl-1-methylcyclohexene Cyclohexene, 1-methyl-4-(1-methylethenyl)-, (4R)- FEMA No. 2633 d-p-Mentha-1,8-diene (+)-4-Isopropenyl-1-methylcyclohexene (R)-(+)-p-Mentha-1,8-diene (4R)-1-methyl-4-(prop-1-en-2-yl)cyclohex-1-ene (R)-1-Methyl-4-(1-methylethenyl)cyclohexene (+)-(R)-Limonene GFD7C86Q1W 4betaH-p-mentha-1,8-diene r-(+)-limonene D-limonene [JAN] (R)-1-Methyl-4-(prop-1-en-2-yl)cyclohex-1-ene CHEBI:15382 (4R)-1-methyl-4-prop-1-en-2-ylcyclohexene (4R)-1-methyl-4-(1-methylethenyl)cyclohexene MFCD00062991 NSC-757069 (4R)-1-methyl-4-isopropenylcyclohex-1-ene DTXSID1020778 (+) Limonene Carvene Glidesafe Glidsafe Kautschiin Refchole D-LIMONENE (IARC) D-LIMONENE [IARC] (4R)-1-Methyl-4-(prop-1-en-2-yl)cyclohexene Biogenic SE 374 (+)-alpha-Limonene d-Limonene (natural) d-Limoneno [Spanish] d limonene d-Limoneno Hemo-sol (4R)-(+)-Limonene Cyclohexene, 1-methyl-4-(1-methylethenyl)-, (R)- (4R)-4-isopropenyl-1-methyl-cyclohexene CCRIS 671 EC 7 HSDB 4186 D-1,8-p-Menthadiene NCI-C55572 EINECS 227-813-5 UNII-GFD7C86Q1W p-Mentha-1,8-diene, (R)-(+)- Sulfate turpentine, distilled (+)-1,8-para-Menthadiene AI3-15191 1-Methyl-4-(1-methylethenyl)cyclohexene, (R)- EINECS 266-034-5 68647-72-3 D-(+)-Limonen Dipentene no. 122 Alda341 ?-LIMONENE Alda 341 Alda-341 EC 227-813-5 (+)-Limonene, stabilized with 0.03% tocopherol DTXCID50778 (D)-LIMONENE [HSDB] (+)-LIMONENE [FCC] CHEMBL449062 Cyclohexene, 1-methyl-4-(1-methylethenyl)-, (theta)- (R)-(+)-Limonene, 95% (R)-(+)-Limonene, 97% CS-M3273 (R)-(+)-Limonene, >=93% Tox21_200400 LIMONENE, (+)- [WHO-DD] AKOS015899935 Purifying Balance Soothing Peeling Pad (R)-4-isopropenyl-1-methylcyclohexene CCG-266134 DB08921 LMPR0102090013 NSC 757069 (R)-(+)-Limonene, analytical standard For terpene analysis, > 99.0% (GC) NCGC00248591-01 NCGC00248591-02 NCGC00257954-01 BS-22387 CAS-5989-27-5 (+)-(R)-4-isopropenyl-1-methylcyclohexene L0047 L0105 NS00008437 (4R)-1-methyl-4-prop-1-en-2-yl-cyclohexene (R)-Limonene 2000 microg/mL in Acetonitrile C06099 D91245 EN300-106573 SVOC Mixture 748 1000 microg/mL in Methanol J-502148 W-105295 BRD-K20879694-001-01-7 Q27888324 Z1255486311 (R)-(+)-Limonene, primary pharmaceutical reference standard (R)-(+)-Limonene, purum, >=96.0% (sum of enantiomers, GC) (R)-(+)-Limonene, technical, ~90% (sum of enantiomers, GC) 7705-13-7 9IR |
| IUPAC Name | (4R)-1-methyl-4-prop-1-en-2-ylcyclohexene |
| SMILES | CC1=CC[C@@H](CC1)C(=C)C |
| Canonical SMILES | CC1=CCC(CC1)C(=C)C |
| InChI | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3/t10-/m0/s1 |
| InChIKey | XMGQYMWWDOXHJM-JTQLQIEISA-N |
| Molecular Weight | 136.23 g/mol |
| XLogP3 | 3.4 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 1 |
| Exact Mass | 136.125 |
| Monoisotopic Mass | 136.125 |
| Topological Polar Surface Area | 0 |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 163 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently-Bonded Unit Count | 1 |
| Insect | Gene Symbol | Validation | Reference |
|---|---|---|---|
| Dendroctonus ponderosae | CYP6DJ1 | X | |
| Dendroctonus ponderosae | CYP345E2 | E |