Methoxyfenozide
| PubChem CID | 105010 |
| Molecular Formula | C22H28N2O3 |
| Structure |
|
| Synonyms |
Methoxyfenozide
161050-58-4 N'-(tert-Butyl )-N'-(3,5-dimethylbenzoyl)-3-methoxy-2-methylbenzohydrazide N'-tert-Butyl-N'-(3,5-dimethylbenzoyl)-3-methoxy-2-methylbenzohydrazide Intrepid Runner 3-Methoxy-2-methylbenzoic acid 2-(3,5-dimethylbenzoyl)-2-(1,1-dimethylethyl)hydrazide Benzoic acid, 3-methoxy-2-methyl-, 2-(3,5-dimethylbenzoyl)-2-(1,1-dimethylethyl)hydrazide N-tert-butyl-N'-(3-methoxy-o-toluoyl)-3,5-xylohydrazide N'-(tert-butyl)-N'-(3,5-dimethylbenzoyl)-3-methoxy-2-methylbenzohydrazide RH-2485 163442-56-6 CHEMBL55772 DTXSID3032628 CHEBI:38449 62A22651ZX Methoxyfenozide 10 microg/mL in Acetonitrile RG 102398; RH 112485; RH 2485 Methoxyphenozide Intrepid (pesticide) Methoxyfenozide [ISO:ANSI:BSI] RH 2485 Prodigy UNII-62A22651ZX HSDB 7936 RG 102398 RH 112485 METHOXYFENOZIDE [MI] SCHEMBL27595 METHOXYFENOZIDE [ISO] DTXCID1012628 BCP10196 Tox21_301100 BDBM50128305 MFCD03792750 3-Methoxy-2-methylbenzoic acid 2-(3,5-dimethylbenzoyl)-2-tert-butylhydrazide AKOS015895784 NCGC00163951-01 NCGC00163951-02 NCGC00163951-03 NCGC00255000-01 DS-16494 DB-241062 HY-117386 RH-112485 CAS-161050-58-4 CS-0065614 NS00000434 A20844 C18525 C73059 Methoxyfenozide, PESTANAL(R), analytical standard J-009776 Q15632812 N-tert-butyl-N''-(3-methoxy-o-toluoyl)-3,5-xylohydrazide N''-tert-butyl-N''-(3,5-dimethylbenzoyl)-3-methoxy-2-methylbenzohydrazide N''-(tert-butyl)-N''-(3,5-dimethylbenzoyl)-3-methoxy-2-methylbenzohydrazide N-(3-methoxy-2-methylbenzoyl)-N'(3,5-dimethylbenzoyl)-N'-tert-butylhydrazine N-(3-methoxy-2-methylbenzoyl)-N'-(3,5-dimethylbenzoyl)-N'-tert-butylhydrazine Benzoic acid, 3-methoxy-2-methyl-, 2-(3,5-dimethyl-benzoyl)-2-(1,1-dimethylethyl)hydrazide |
Computed Descriptors
| IUPAC Name | N'-tert-butyl-N'-(3,5-dimethylbenzoyl)-3-methoxy-2-methylbenzohydrazide |
| SMILES | CC1=CC(=CC(=C1)C(=O)N(C(C)(C)C)NC(=O)C2=C(C(=CC=C2)OC)C)C |
| Canonical SMILES | CC1=CC(=CC(=C1)C(=O)N(C(C)(C)C)NC(=O)C2=C(C(=CC=C2)OC)C)C |
| InChI | InChI=1S/C22H28N2O3/c1-14-11-15(2)13-17(12-14)21(26)24(22(4,5)6)23-20(25)18-9-8-10-19(27-7)16(18)3/h8-13H,1-7H3,(H,23,25) |
| InChIKey | QCAWEPFNJXQPAN-UHFFFAOYSA-N |
Computed Properties
Show more
| Molecular Weight | 368.5 g/mol |
| XLogP3 | 4.6 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 4 |
| Exact Mass | 368.21 |
| Monoisotopic Mass | 368.21 |
| Topological Polar Surface Area | 58.6 |
| Heavy Atom Count | 27 |
| Formal Charge | 0 |
| Complexity | 518 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently-Bonded Unit Count | 1 |
Annotation
2 pairs of Verified P450 and Methoxyfenozide
| Insect | Gene Symbol | Validation | Reference |
|---|---|---|---|
| Spodoptera exigua | CYP9A9 | R | |
| Spodoptera litura | CYP9A40 | R |