| PubChem CID | 22311 |
| Molecular Formula | C10H16 |
| Structure |
|
| Synonyms |
LIMONENE
Dipentene 138-86-3 Cinene Cajeputene DL-Limonene Kautschin Dipenten Eulimen Nesol p-Mentha-1,8-diene 1,8-p-Menthadiene Cajeputen Limonen Cinen Inactive limonene Acintene DP dipentene (+/-)-Limonene 1-Methyl-4-(1-methylethenyl)cyclohexene Cyclohexene, 1-methyl-4-(1-methylethenyl)- Unitene alpha-Limonene Flavor orange Orange flavor Goldflush II 4-Isopropenyl-1-methylcyclohexene Acintene DP 4-Isopropenyl-1-methyl-1-cyclohexene Dipanol Di-p-mentha-1,8-diene 1,8(9)-p-Menthadiene d,l-Limonene Limonene, dl- 7705-14-8 Dipentene 200 (+-)-Dipentene DL-4-Isopropenyl-1-methylcyclohexene (+-)-Linonene Caswell No. 526 delta-1,8-Terpodiene p-Mentha-1,8-diene, dl- (+-)-alpha-Limonene Dipentene, crude 1-methyl-4-(prop-1-en-2-yl)cyclohex-1-ene MENTHA-1,8-DIENE (DL) NSC 21446 PC 560 1-Methyl-4-isopropenyl-1-cyclohexene Terpodiene Ciene Cyclil decene HSDB 1809 Limonene, (+/-)- NSC 844 Orange x Dipentene, technical grade p-Mentha-1,8-diene, (+-)- .alpha.-Limonene DIPENTENE (+-) EINECS 205-341-0 EINECS 231-732-0 1-Methyl-p-isopropenyl-1-cyclohexene EPA Pesticide Chemical Code 079701 1-methyl-4-prop-1-en-2-ylcyclohexene Mentha-1,8-diene DTXSID2029612 UNII-9MC3I34447 CHEBI:15384 AI3-00739 NSC-844 NSC-21446 (+-)-(RS)-limonene DL-p-mentha-1,8-diene Mentha-1,8-diene, DL .delta.-1,8-Terpodiene 8016-20-4 9MC3I34447 Terpenes and Terpenoids, limonene fraction Methyl-4-isopropenylcyclohexene DTXCID209612 NSC844 65996-98-7 (1)-1-Methyl-4-(1-methylvinyl)cyclohexene 1-Methyl-4-isopropenylcyclohexene Methyl-4-isopropenyl-1-cyclohexene NSC21446 Methyl-4-(1-methylethenyl)cyclohexene NCGC00163742-03 4-(1-methylethenyl)-1-methyl-cyclohexene (+/-)-1-METHYL-4-(1-METHYLETHENYL)CYCLOHEXENE Cyclohexene, 1-methyl-4-(1-methylethenyl)-, (.+/-.)- Limonene 1000 microg/mL in Isopropanol CAS-138-86-3 4-mentha-1,8-diene TERPIN MONOHYDRATE IMPURITY C (EP IMPURITY) TERPIN MONOHYDRATE IMPURITY C [EP IMPURITY] Cyclohexene, 1-methyl-4-(1-methylethenyl)-, (R)- UN2052 Achilles dipentene Dipentene, tech. 4-isopropenyl-1-methyl-cyclohexene Nesol/from Table/ c0626 p-Mentha-1, dl- d(R)-4-Isopropenyl-1-methylcyclohexene limonene, (+-)- (.+-.)-Limonene (.+-.)-Dipentene p-Menthane/from Table/ 4 Mentha 1,8 diene LIMONENE [HSDB] LIMONENE [MI] (.+/-.)-Dipentene (.+/-.)-Limonene DIPENTENE [VANDF] DIPENTEN [WHO-DD] Cyclohexene, (.+-.)- Dipentene, p.a., 95% (+-)-LIMONENE 1-METHYL-4-PROP-1-EN-2-YL-CYCLOHEXENE p-Mentha-1,8(9)-diene CHEMBL15799 (.+/-.)-.alpha.-Limonene (+/-)-p-Mentha-1,8-diene p-Mentha-1, (.+-.)- HMS3264E05 Pharmakon1600-00307080 HY-N0544 LIMONENE, (+/-)-(II) Tox21_112068 Tox21_201818 Tox21_303409 MFCD00062992 NSC757069 STK801934 1-methyl-4-isopropenylcyclohex-1-ene LIMONENE, (+/-)- [II] AKOS009031280 Cyclohexene, 4-Isopropenyl-1-methyl- USEPA/OPP Pesticide Code 079701 WLN: L6UTJ A1 DY1 & U1 CCG-214016 FS-8076 p-Mentha-1,8-diene, (.+/-.)- SB44847 UN 2052 NCGC00163742-01 NCGC00163742-02 NCGC00163742-04 NCGC00163742-05 NCGC00257291-01 NCGC00259367-01 turpentine oil terpenes limonene fraction DA-75016 NCI60_041856 1-methyl-4-(1-methylethenyl) cylcohexene 1-methyl-4-(prop-1-en-2-yl)cyclohexene Dipentene [UN2052] [Flammable liquid] Cyclohexene, 1-methyl-4-(1-methylethynyl) DB-053490 DB-072716 CS-0009072 L0046 NS00067923 EN300-21627 C06078 D00194 E88572 AB01563249_01 Q278809 SR-01000872759 CYCLOHEXENE 1-METHYL-4-(1-METHYLETHENYL)- J-007186 J-520048 SR-01000872759-1 BRD-A81494260-001-02-5 4B4F06FC-8293-455D-8FD5-C970CDB001EE Dipentene, mixt. of limonene, 56-64%, and terpinolene, 20-25% 1-Methyl-4-(1-methylethenyl)-or 1-methyl-4-isopropenyl-cyclohex-1-ene 65996-99-8 |
| IUPAC Name | 1-methyl-4-prop-1-en-2-ylcyclohexene |
| SMILES | CC1=CCC(CC1)C(=C)C |
| Canonical SMILES | CC1=CCC(CC1)C(=C)C |
| InChI | InChI=1S/C10H16/c1-8(2)10-6-4-9(3)5-7-10/h4,10H,1,5-7H2,2-3H3 |
| InChIKey | XMGQYMWWDOXHJM-UHFFFAOYSA-N |
| Molecular Weight | 136.23 g/mol |
| XLogP3 | 3.4 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 1 |
| Exact Mass | 136.125 |
| Monoisotopic Mass | 136.125 |
| Topological Polar Surface Area | 0 |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 163 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently-Bonded Unit Count | 1 |
| Insect | Gene Symbol | Validation | Reference |
|---|---|---|---|
| Dendroctonus armandi | CYP6CR2 | R | |
| Dendroctonus armandi | CYP6DE5 | R | |
| Sitophilus zeamais | CYP6MS1 | R | |
| Sitophilus zeamais | CYP6MS5 | R | |
| Sitophilus zeamais | CYP6MS6 | R | |
| Sitophilus zeamais | CYP6MS8 | R | |
| Sitophilus zeamais | CYP6MS9 | R |