a-Pinene
| PubChem CID | 11240513 |
| Molecular Formula | C10H16 |
| Structure |
|
| Synonyms |
a-pinene
CHEBI:211833 (1R,5S)-3,6,6-trimethylbicyclo[3.1.1]hept-2-ene |
Computed Descriptors
| IUPAC Name | (1R,5S)-3,6,6-trimethylbicyclo[3.1.1]hept-2-ene |
| SMILES | CC1=C[C@H]2C[C@@H](C1)C2(C)C |
| Canonical SMILES | CC1=CC2CC(C1)C2(C)C |
| InChI | InChI=1S/C10H16/c1-7-4-8-6-9(5-7)10(8,2)3/h4,8-9H,5-6H2,1-3H3/t8-,9+/m0/s1 |
| InChIKey | ZJUDTXCEVUJEOX-DTWKUNHWSA-N |
Computed Properties
Show more
| Molecular Weight | 136.23 g/mol |
| XLogP3 | 2.8 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 0 |
| Exact Mass | 136.125 |
| Monoisotopic Mass | 136.125 |
| Topological Polar Surface Area | 0 |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 186 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| Covalently-Bonded Unit Count | 1 |
0 pairs of Verified P450 and a-Pinene
| Insect | Gene Symbol | Validation | Reference |
|---|